EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H24N2O5 |
| Net Charge | 0 |
| Average Mass | 456.498 |
| Monoisotopic Mass | 456.16852 |
| SMILES | COc1cc([C@H](Cc2ccccc2)n2cc(C(N)=O)c(=O)cc2Cc2ccccc2)oc(=O)c1 |
| InChI | InChI=1S/C27H24N2O5/c1-33-21-15-25(34-26(31)16-21)23(13-19-10-6-3-7-11-19)29-17-22(27(28)32)24(30)14-20(29)12-18-8-4-2-5-9-18/h2-11,14-17,23H,12-13H2,1H3,(H2,28,32)/t23-/m0/s1 |
| InChIKey | CPVCVIXCXKPURM-QHCPKHFHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus niger (ncbitaxon:5061) | |||
| - | PubMed (15387655) | ||
| - | DOI (10.1021/np058103o) |
| Roles Classification |
|---|
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aspernigrin B (CHEBI:133847) has role Aspergillus metabolite (CHEBI:76956) |
| aspernigrin B (CHEBI:133847) has role neuroprotective agent (CHEBI:63726) |
| aspernigrin B (CHEBI:133847) is a 2-pyranones (CHEBI:75885) |
| aspernigrin B (CHEBI:133847) is a 4-pyridones (CHEBI:20485) |
| aspernigrin B (CHEBI:133847) is a aromatic ether (CHEBI:35618) |
| aspernigrin B (CHEBI:133847) is a monocarboxylic acid amide (CHEBI:29347) |
| aspernigrin B (CHEBI:133847) is a pyridine alkaloid (CHEBI:26416) |
| IUPAC Name |
|---|
| 6-benzyl-1-[(1S)-1-(4-methoxy-2-oxo-2H-pyran-6-yl)-2-phenylethyl]-4-oxo-1,4-dihydropyridine-3-carboxamide |
| Manual Xrefs | Databases |
|---|---|
| C00043300 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:29214437 | Reaxys |
| CAS:773855-63-3 | KNApSAcK |
| Citations |
|---|