EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32O3 |
| Net Charge | 0 |
| Average Mass | 344.495 |
| Monoisotopic Mass | 344.23514 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C[C@@]12O[C@@H]1[C@H](O)C(C)=CC2=O |
| InChI | InChI=1S/C22H32O3/c1-15(2)8-6-9-16(3)10-7-11-17(4)12-13-22-19(23)14-18(5)20(24)21(22)25-22/h8,10,12,14,20-21,24H,6-7,9,11,13H2,1-5H3/b16-10+,17-12+/t20-,21-,22+/m1/s1 |
| InChIKey | DKOXVDVXOYHFHV-ITGDQCKOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus niger ATCC 1015 (ncbitaxon:380704) | - | PubMed (24684908) | |
| Gliomastix sp. ZSDS1-F7 (ncbitaxon:1769178) | - | PubMed (27417331) | The fungus Gliomastix sp. ZSDS1-F7 was isolated from the sponge Phakellia fusca |
| Penicillium chrysogenum (ncbitaxon:5076) | - | PubMed (15974609) | |
| Penicillium sp. (ncbitaxon:5081) | - | PubMed (14640527) |
| Roles Classification |
|---|
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-deacetoxyyanuthone A (CHEBI:133843) has role Aspergillus metabolite (CHEBI:76956) |
| 7-deacetoxyyanuthone A (CHEBI:133843) is a class I yanuthone (CHEBI:133075) |
| 7-deacetoxyyanuthone A (CHEBI:133843) is a secondary alcohol (CHEBI:35681) |
| Incoming Relation(s) |
| 22-deacetylyanuthone A (CHEBI:133844) has functional parent 7-deacetoxyyanuthone A (CHEBI:133843) |
| yanuthone F (CHEBI:133835) has functional parent 7-deacetoxyyanuthone A (CHEBI:133843) |
| yanuthone K (CHEBI:133035) has functional parent 7-deacetoxyyanuthone A (CHEBI:133843) |
| IUPAC Name |
|---|
| (1R,5R,6R)-5-hydroxy-4-methyl-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]-7-oxabicyclo[4.1.0]hept-3-en-2-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9804191 | Reaxys |
| Citations |
|---|