EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8O2 |
| Net Charge | 0 |
| Average Mass | 124.139 |
| Monoisotopic Mass | 124.05243 |
| SMILES | Cc1cc(O)ccc1O |
| InChI | InChI=1S/C7H8O2/c1-5-4-6(8)2-3-7(5)9/h2-4,8-9H,1H3 |
| InChIKey | CNHDIAIOKMXOLK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium sp. (ncbitaxon:5081) | - | PubMed (23603293) | Penicillium sp. HL-85-ALS5-R004 |
| Roles Classification |
|---|
| Biological Role: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| toluquinol (CHEBI:133842) has role Penicillium metabolite (CHEBI:76964) |
| toluquinol (CHEBI:133842) has role angiogenesis inhibitor (CHEBI:48422) |
| toluquinol (CHEBI:133842) has role anti-inflammatory agent (CHEBI:67079) |
| toluquinol (CHEBI:133842) is a hydroquinones (CHEBI:24646) |
| IUPAC Name |
|---|
| 2-methylbenzene-1,4-diol |
| Synonyms | Source |
|---|---|
| 1,4-dihydroxy-2-methylbenzene | ChemIDplus |
| 2,5-dihydroxytoluene | ChemIDplus |
| 2,5-toluenediol | ChemIDplus |
| 2-methylhydroquinone | ChEBI |
| p-toluhydroquinol | NIST Chemistry WebBook |
| p-toluhydroquinone | NIST Chemistry WebBook |
| Citations |
|---|