EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H42O9 |
| Net Charge | 0 |
| Average Mass | 522.635 |
| Monoisotopic Mass | 522.28288 |
| SMILES | CC1=CC(=O)[C@]2(C/C=C(\C)CC/C=C(\C)CC/C=C(\C)CO)O[C@@H]2[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C28H42O9/c1-16(8-6-10-18(3)14-29)7-5-9-17(2)11-12-28-21(31)13-19(4)25(26(28)37-28)36-27-24(34)23(33)22(32)20(15-30)35-27/h7,10-11,13,20,22-27,29-30,32-34H,5-6,8-9,12,14-15H2,1-4H3/b16-7+,17-11+,18-10+/t20-,22-,23+,24-,25-,26-,27+,28+/m1/s1 |
| InChIKey | CBEGKNQNKAZQEF-CERRFSKRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus niger ATCC 1015 (ncbitaxon:380704) | - | PubMed (24684908) |
| Roles Classification |
|---|
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| yanuthone G (CHEBI:133839) has functional parent yanuthone F (CHEBI:133835) |
| yanuthone G (CHEBI:133839) has role Aspergillus metabolite (CHEBI:76956) |
| yanuthone G (CHEBI:133839) is a class I yanuthone (CHEBI:133075) |
| yanuthone G (CHEBI:133839) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| (1R,2R,6R)-6-[(2E,6E,10E)-12-hydroxy-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]-3-methyl-5-oxo-7-oxabicyclo[4.1.0]hept-3-en-2-yl β-D-glucopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:27020141 | Reaxys |
| Citations |
|---|