EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H24O6 |
| Net Charge | 0 |
| Average Mass | 324.373 |
| Monoisotopic Mass | 324.15729 |
| SMILES | C/C(=C\C[C@@]12O[C@@H]1[C@H](O)C(CO)=CC2=O)CCCC(C)C(=O)O |
| InChI | InChI=1S/C17H24O6/c1-10(4-3-5-11(2)16(21)22)6-7-17-13(19)8-12(9-18)14(20)15(17)23-17/h6,8,11,14-15,18,20H,3-5,7,9H2,1-2H3,(H,21,22)/b10-6+/t11?,14-,15-,17+/m1/s1 |
| InChIKey | AKKLRAIOYFECEG-BQPVOTJVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus niger ATCC 1015 (ncbitaxon:380704) | - | PubMed (24684908) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| yanuthone I (CHEBI:133837) has role Aspergillus metabolite (CHEBI:76956) |
| yanuthone I (CHEBI:133837) is a class I yanuthone (CHEBI:133075) |
| yanuthone I (CHEBI:133837) is a monocarboxylic acid (CHEBI:25384) |
| yanuthone I (CHEBI:133837) is a primary alcohol (CHEBI:15734) |
| yanuthone I (CHEBI:133837) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (6E)-8-[(1R,5R,6R)-5-hydroxy-4-(hydroxymethyl)-2-oxo-7-oxabicyclo[4.1.0]hept-3-en-1-yl]-2,6-dimethyloct-6-enoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:27020144 | Reaxys |
| Citations |
|---|