EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H12N4O3 |
| Net Charge | 0 |
| Average Mass | 260.253 |
| Monoisotopic Mass | 260.09094 |
| SMILES | O=C(Cn1ccnc1[N+](=O)[O-])NCc1ccccc1 |
| InChI | InChI=1S/C12H12N4O3/c17-11(14-8-10-4-2-1-3-5-10)9-15-7-6-13-12(15)16(18)19/h1-7H,8-9H2,(H,14,17) |
| InChIKey | CULUWZNBISUWAS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. |
| Applications: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benznidazole (CHEBI:133833) has role antileishmanial agent (CHEBI:70868) |
| benznidazole (CHEBI:133833) has role antiprotozoal drug (CHEBI:35820) |
| benznidazole (CHEBI:133833) has role trypanocidal drug (CHEBI:36335) |
| benznidazole (CHEBI:133833) is a C-nitro compound (CHEBI:35716) |
| benznidazole (CHEBI:133833) is a imidazoles (CHEBI:24780) |
| benznidazole (CHEBI:133833) is a monocarboxylic acid amide (CHEBI:29347) |
| IUPAC Name |
|---|
| N-benzyl-2-(2-nitro-1H-imidazol-1-yl)acetamide |
| INNs | Source |
|---|---|
| benznidazol | ChemIDplus |
| benznidazole | KEGG DRUG |
| benznidazole | ChemIDplus |
| benznidazolum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-Nitro-N-(phenylmethyl)-1H-imidazole-1-acetamide | ChemIDplus |
| N-Benzyl-2-nitroimidazol-1-yl-acetamide | ChemIDplus |
| N-Benzyl-2-nitroimidazole-1-acetamide | ChemIDplus |
| NSC-299972 | ChEMBL |
| RO 07-1051 | ChEMBL |
| RO-07-1051 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 322 | DrugCentral |
| Benznidazole | Wikipedia |
| D02489 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:551486 | Reaxys |
| CAS:22994-85-0 | KEGG DRUG |
| CAS:22994-85-0 | ChemIDplus |
| Citations |
|---|