EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H59NO13 |
| Net Charge | 0 |
| Average Mass | 689.840 |
| Monoisotopic Mass | 689.39864 |
| SMILES | CCCC[C@@H](C)[C@@H](OC(=O)C[C@@H](CC(=O)O)C(=O)O)[C@H](C[C@@H](C)CCCCCCCC[C@H](O)[C@H](C)N)OC(=O)C[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C34H59NO13/c1-5-6-14-22(3)32(48-31(42)20-25(34(45)46)18-29(39)40)27(47-30(41)19-24(33(43)44)17-28(37)38)16-21(2)13-11-9-7-8-10-12-15-26(36)23(4)35/h21-27,32,36H,5-20,35H2,1-4H3,(H,37,38)(H,39,40)(H,43,44)(H,45,46)/t21-,22+,23-,24+,25+,26-,27-,32+/m0/s1 |
| InChIKey | WYYKRDVIBOEORL-JLCKPESSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus niger (ncbitaxon:5061) | - | PubMed (20014861) | From Aspergillus niger on grapes and raisins. |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . mycotoxin Poisonous substance produced by fungi. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fumonisin B4 (CHEBI:133832) has role Aspergillus metabolite (CHEBI:76956) |
| fumonisin B4 (CHEBI:133832) is a diester (CHEBI:51307) |
| fumonisin B4 (CHEBI:133832) is a fumonisin (CHEBI:38224) |
| fumonisin B4 (CHEBI:133832) is a primary amino compound (CHEBI:50994) |
| fumonisin B4 (CHEBI:133832) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (2R,2'R)-2,2'-{[(5R,6R,7S,9S,18S,19S)-19-amino-18-hydroxy-5,9-dimethylicosane-6,7-diyl]bis[oxy(2-oxoethane-2,1-diyl)]}disuccinic acid |
| Synonym | Source |
|---|---|
| fumonisin B4 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19781280 | Reaxys |
| CAS:136379-60-7 | ChemIDplus |