EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H22O6 |
| Net Charge | 0 |
| Average Mass | 286.324 |
| Monoisotopic Mass | 286.14164 |
| SMILES | C=C(C(=O)O)C(CCCCCCCC(=O)OC)C(=O)O |
| InChI | InChI=1S/C14H22O6/c1-10(13(16)17)11(14(18)19)8-6-4-3-5-7-9-12(15)20-2/h11H,1,3-9H2,2H3,(H,16,17)(H,18,19) |
| InChIKey | IOUNJEVHPQCKKE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus niger (ncbitaxon:5061) | - | PubMed (17827758) | Culture broth of Aspergillus niger FKI-2342 isolated from soil collected at Ooura Tensyudou, Nagasaki, Japan Strain: FKI-2342 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tensyuic acid E (CHEBI:133831) has role Aspergillus metabolite (CHEBI:76956) |
| tensyuic acid E (CHEBI:133831) is a dicarboxylic acid (CHEBI:35692) |
| tensyuic acid E (CHEBI:133831) is a methyl ester (CHEBI:25248) |
| tensyuic acid E (CHEBI:133831) is a tensyuic acid (CHEBI:133873) |
| IUPAC Names |
|---|
| (3Ξ)-2-(8-methoxy-8-oxooctyl)-3-methylidenebutanedioic acid |
| (3Ξ)-2-(8-methoxy-8-oxooctyl)-3-methylenesuccinic acid |
| Synonyms | Source |
|---|---|
| (+)-2-(8-methoxy-8-oxooctyl)-3-methylidenebutanedioic acid | ChEBI |
| (+)-tensyuic acid E | ChEBI |
| (+)-2-(8-methoxy-8-oxooctyl)-3-methylenesuccinic acid | ChEBI |
| Citations |
|---|