EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:133829 - tensyuic acid C
| Formula | C13H20O6 |
| Net Charge | 0 |
| Average Mass | 272.297 |
| Monoisotopic Mass | 272.12599 |
| SMILES | C=C(C(=O)O)C(CCCCCC(=O)OCC)C(=O)O |
| InChI | InChI=1S/C13H20O6/c1-3-19-11(14)8-6-4-5-7-10(13(17)18)9(2)12(15)16/h10H,2-8H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | STUMFFBVBKIJSG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus niger (ncbitaxon:5061) | - | PubMed (17827758) | Culture broth of Aspergillus niger FKI-2342 isolated from soil collected at Ooura Tensyudou, Nagasaki, Japan Strain: FKI-2342 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tensyuic acid C (CHEBI:133829) has role Aspergillus metabolite (CHEBI:76956) |
| tensyuic acid C (CHEBI:133829) has role antibacterial agent (CHEBI:33282) |
| tensyuic acid C (CHEBI:133829) is a dicarboxylic acid (CHEBI:35692) |
| tensyuic acid C (CHEBI:133829) is a ethyl ester (CHEBI:23990) |
| tensyuic acid C (CHEBI:133829) is a tensyuic acid (CHEBI:133873) |
| IUPAC Names |
|---|
| (2Ξ)-2-(6-ethoxy-6-oxohexyl)-3-methylenesuccinic acid |
| (2Ξ)-2-(6-ethoxy-6-oxohexyl)-3-methylidenebutanedioic acid |
| Synonyms | Source |
|---|---|
| (−)-tensyuic acid C | ChEBI |
| (−)-2-(6-ethoxy-6-oxohexyl)-3-methylenesuccinic acid | ChEBI |
| (−)-2-(6-ethoxy-6-oxohexyl)-3-methylidenebutanedioic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11209668 | Reaxys |
| Citations |
|---|