EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16O6 |
| Net Charge | 0 |
| Average Mass | 244.243 |
| Monoisotopic Mass | 244.09469 |
| SMILES | C=C(C(=O)O)C(CCCC(=O)OCC)C(=O)O |
| InChI | InChI=1S/C11H16O6/c1-3-17-9(12)6-4-5-8(11(15)16)7(2)10(13)14/h8H,2-6H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | DFYGVGBRRIMUSH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus niger (ncbitaxon:5061) | - | PubMed (17827758) | Culture broth of Aspergillus niger FKI-2342 isolated from soil collected at Ooura Tensyudou, Nagasaki, Japan Strain: FKI-2342 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tensyuic acid F (CHEBI:133828) has role Aspergillus metabolite (CHEBI:76956) |
| tensyuic acid F (CHEBI:133828) is a dicarboxylic acid (CHEBI:35692) |
| tensyuic acid F (CHEBI:133828) is a ethyl ester (CHEBI:23990) |
| tensyuic acid F (CHEBI:133828) is a tensyuic acid (CHEBI:133873) |
| IUPAC Names |
|---|
| (2Ξ)-2-(4-ethoxy-4-oxobutyl)-3-methylidenebutanedioic acid |
| (2Ξ)-2-(4-ethoxy-4-oxobutyl)-3-methylenesuccinic acid |
| Synonyms | Source |
|---|---|
| (−)-2-(4-ethoxy-4-oxobutyl)-3-methylidenebutanedioic acid | ChEBI |
| (−)-2-(4-ethoxy-4-oxobutyl)-3-methylenesuccinic acid | ChEBI |
| (−)-tensyuic acid F | ChEBI |
| Citations |
|---|