EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:133824 - GNF6702
| Formula | C22H16FN7O2 |
| Net Charge | 0 |
| Average Mass | 429.415 |
| Monoisotopic Mass | 429.13495 |
| SMILES | Cc1nc(C)c(C(=O)Nc2ccc(F)c(-c3nc4ncc(-c5ccccn5)cn4n3)c2)o1 |
| InChI | InChI=1S/C22H16FN7O2/c1-12-19(32-13(2)26-12)21(31)27-15-6-7-17(23)16(9-15)20-28-22-25-10-14(11-30(22)29-20)18-5-3-4-8-24-18/h3-11H,1-2H3,(H,27,31) |
| InChIKey | WXZFCGRYVWYYTG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| Applications: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. proteasome inhibitor A drug that blocks the action of proteasomes, cellular complexes that break down proteins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GNF6702 (CHEBI:133824) has role antileishmanial agent (CHEBI:70868) |
| GNF6702 (CHEBI:133824) has role proteasome inhibitor (CHEBI:52726) |
| GNF6702 (CHEBI:133824) is a 1,3-oxazoles (CHEBI:46812) |
| GNF6702 (CHEBI:133824) is a aromatic amide (CHEBI:62733) |
| GNF6702 (CHEBI:133824) is a monofluorobenzenes (CHEBI:83575) |
| GNF6702 (CHEBI:133824) is a pyridines (CHEBI:26421) |
| GNF6702 (CHEBI:133824) is a ring assembly (CHEBI:36820) |
| GNF6702 (CHEBI:133824) is a triazolopyrimidines (CHEBI:48435) |
| IUPAC Name |
|---|
| N-{4-fluoro-3-[6-(pyridin-2-yl)[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]phenyl}-2,4-dimethyl-1,3-oxazole-5-carboxamide |
| Synonyms | Source |
|---|---|
| GNF 6702 | ChEBI |
| GNF-6702 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| GNF6702 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:28255207 | Reaxys |
| Citations |
|---|