EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:133824 - GNF6702
| Formula | C22H16FN7O2 |
| Net Charge | 0 |
| Average Mass | 429.415 |
| Monoisotopic Mass | 429.13495 |
| SMILES | Cc1nc(C)c(C(=O)Nc2ccc(F)c(-c3nc4ncc(-c5ccccn5)cn4n3)c2)o1 |
| InChI | InChI=1S/C22H16FN7O2/c1-12-19(32-13(2)26-12)21(31)27-15-6-7-17(23)16(9-15)20-28-22-25-10-14(11-30(22)29-20)18-5-3-4-8-24-18/h3-11H,1-2H3,(H,27,31) |
| InChIKey | WXZFCGRYVWYYTG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| Applications: | proteasome inhibitor A drug that blocks the action of proteasomes, cellular complexes that break down proteins. antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GNF6702 (CHEBI:133824) has role antileishmanial agent (CHEBI:70868) |
| GNF6702 (CHEBI:133824) has role proteasome inhibitor (CHEBI:52726) |
| GNF6702 (CHEBI:133824) is a 1,3-oxazoles (CHEBI:46812) |
| GNF6702 (CHEBI:133824) is a aromatic amide (CHEBI:62733) |
| GNF6702 (CHEBI:133824) is a monofluorobenzenes (CHEBI:83575) |
| GNF6702 (CHEBI:133824) is a pyridines (CHEBI:26421) |
| GNF6702 (CHEBI:133824) is a ring assembly (CHEBI:36820) |
| GNF6702 (CHEBI:133824) is a triazolopyrimidines (CHEBI:48435) |
| IUPAC Name |
|---|
| N-{4-fluoro-3-[6-(pyridin-2-yl)[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]phenyl}-2,4-dimethyl-1,3-oxazole-5-carboxamide |
| Synonyms | Source |
|---|---|
| GNF 6702 | ChEBI |
| GNF-6702 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| GNF6702 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:28255207 | Reaxys |
| Citations |
|---|