EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H10ClN3O3 |
| Net Charge | 0 |
| Average Mass | 339.738 |
| Monoisotopic Mass | 339.04107 |
| SMILES | O=C(Nc1ccc(Cl)c(-c2nc3ncccc3o2)c1)c1ccco1 |
| InChI | InChI=1S/C17H10ClN3O3/c18-12-6-5-10(20-16(22)14-4-2-8-23-14)9-11(12)17-21-15-13(24-17)3-1-7-19-15/h1-9H,(H,20,22) |
| InChIKey | SRIJDRMKAJOZAJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | proteasome inhibitor A drug that blocks the action of proteasomes, cellular complexes that break down proteins. antiparasitic agent A substance used to treat or prevent parasitic infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GNF5343 (CHEBI:133823) has functional parent 2-furoic acid (CHEBI:30845) |
| GNF5343 (CHEBI:133823) has role antiparasitic agent (CHEBI:35442) |
| GNF5343 (CHEBI:133823) has role proteasome inhibitor (CHEBI:52726) |
| GNF5343 (CHEBI:133823) is a aromatic amide (CHEBI:62733) |
| GNF5343 (CHEBI:133823) is a furans (CHEBI:24129) |
| GNF5343 (CHEBI:133823) is a monochlorobenzenes (CHEBI:83403) |
| GNF5343 (CHEBI:133823) is a oxazolopyridine (CHEBI:38765) |
| GNF5343 (CHEBI:133823) is a ring assembly (CHEBI:36820) |
| IUPAC Name |
|---|
| N-[4-chloro-3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]furan-2-carboxamide |
| Synonyms | Source |
|---|---|
| GNF 5343 | ChEBI |
| GNF-5343 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23966224 | Reaxys |
| Citations |
|---|