EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H37N7O3 |
| Net Charge | 0 |
| Average Mass | 567.694 |
| Monoisotopic Mass | 567.29579 |
| SMILES | COc1ccc(N(C(=O)Nc2c(C)cccc2C)c2cc(Nc3ccc(N4CCN(C)CC4)cc3)ncn2)c(OC)c1 |
| InChI | InChI=1S/C32H37N7O3/c1-22-7-6-8-23(2)31(22)36-32(40)39(27-14-13-26(41-4)19-28(27)42-5)30-20-29(33-21-34-30)35-24-9-11-25(12-10-24)38-17-15-37(3)16-18-38/h6-14,19-21H,15-18H2,1-5H3,(H,36,40)(H,33,34,35) |
| InChIKey | UYUHRKLITDJEHB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | salt-inducible kinase 2 inhibitor Any protein kinase inhibitor that interferes with the action of salt-inducible kinase 2. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| HG-9-91-01 (CHEBI:133818) has role antineoplastic agent (CHEBI:35610) |
| HG-9-91-01 (CHEBI:133818) has role salt-inducible kinase 2 inhibitor (CHEBI:133891) |
| HG-9-91-01 (CHEBI:133818) is a N-alkylpiperazine (CHEBI:46845) |
| HG-9-91-01 (CHEBI:133818) is a N-arylpiperazine (CHEBI:46848) |
| HG-9-91-01 (CHEBI:133818) is a aminopyrimidine (CHEBI:38338) |
| HG-9-91-01 (CHEBI:133818) is a dimethoxybenzene (CHEBI:51681) |
| HG-9-91-01 (CHEBI:133818) is a phenylureas (CHEBI:134043) |
| HG-9-91-01 (CHEBI:133818) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| N-(2,4-dimethoxyphenyl)-N'-(2,6-dimethylphenyl)-N-{6-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl}urea |
| Registry Numbers | Sources |
|---|---|
| Reaxys:24079892 | Reaxys |
| Citations |
|---|