EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O5 |
| Net Charge | 0 |
| Average Mass | 286.283 |
| Monoisotopic Mass | 286.08412 |
| SMILES | COc1cc(OC)c2c(c1)cc(O)c1c(=O)cc(C)oc12 |
| InChI | InChI=1S/C16H14O5/c1-8-4-11(17)15-12(18)6-9-5-10(19-2)7-13(20-3)14(9)16(15)21-8/h4-7,18H,1-3H3 |
| InChIKey | ARXPDHLVDOYIPX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus niger (ncbitaxon:5061) | - | DOI (10.1039/JR9620000040) | |
| Aspergillus awamori (ncbitaxon:105351) | - | PubMed (26669099) | |
| Aspergillus carbonarius (ncbitaxon:40993) | - | PubMed (18205129) |
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. acyl-CoA:cholesterol acyltransferase 2 inhibitor A sterol O-acyltransferase inhibitor that specifically inhibits acyl-CoA:cholesterol acyltransferase 2. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flavasperone (CHEBI:133814) has role Aspergillus metabolite (CHEBI:76956) |
| flavasperone (CHEBI:133814) has role acyl-CoA:cholesterol acyltransferase 2 inhibitor (CHEBI:64697) |
| flavasperone (CHEBI:133814) has role antiviral agent (CHEBI:22587) |
| flavasperone (CHEBI:133814) has role marine metabolite (CHEBI:76507) |
| flavasperone (CHEBI:133814) is a aromatic ether (CHEBI:35618) |
| flavasperone (CHEBI:133814) is a naphtho-γ-pyrone (CHEBI:64542) |
| flavasperone (CHEBI:133814) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 5-hydroxy-8,10-dimethoxy-2-methyl-4H-naphtho[1,2-b]pyran-4-one |
| Synonyms | Source |
|---|---|
| asperxanthone | SUBMITTER |
| Asperxanthon | ChemIDplus |
| TMC 256c2 | HMDB |
| Antibiotic TMC 256c2 | HMDB |
| Manual Xrefs | Databases |
|---|---|
| 4678011 | ChemSpider |
| HMDB0030852 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:280885 | Reaxys |
| CAS:3566-99-2 | ChemIDplus |
| Citations |
|---|