EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:133813 - asperenone
| Formula | C20H22O |
| Net Charge | 0 |
| Average Mass | 278.395 |
| Monoisotopic Mass | 278.16707 |
| SMILES | CCC(=O)/C=C/C=C/C(C)=C/C=C/C=C/c1ccccc1 |
| InChI | InChI=1S/C20H22O/c1-3-20(21)17-11-10-13-18(2)12-6-4-7-14-19-15-8-5-9-16-19/h4-17H,3H2,1-2H3/b6-4+,13-10+,14-7+,17-11+,18-12+ |
| InChIKey | KMNUJIARVHVQCF-SVCWYOIUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus niger (ncbitaxon:5061) | |||
| - | DOI (10.1016/S0040-4039(01)88611-1) | ||
| - | PubMed (6073032) | Strain: NRRL 3 |
| Roles Classification |
|---|
| Biological Roles: | lipoxygenase inhibitor A compound or agent that combines with lipoxygenase and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of the icosanoid products hydroxyicosatetraenoic acid and various leukotrienes. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| Application: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asperenone (CHEBI:133813) has role Aspergillus metabolite (CHEBI:76956) |
| asperenone (CHEBI:133813) has role lipoxygenase inhibitor (CHEBI:35856) |
| asperenone (CHEBI:133813) has role platelet aggregation inhibitor (CHEBI:50427) |
| asperenone (CHEBI:133813) is a enone (CHEBI:51689) |
| IUPAC Name |
|---|
| (4E,6E,8E,10E,12E)-8-methyl-13-phenyltrideca-4,6,8,10,12-pentaen-3-one |
| Synonym | Source |
|---|---|
| asperyellone | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1970631 | Reaxys |
| Citations |
|---|