EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12O3 |
| Net Charge | 0 |
| Average Mass | 252.269 |
| Monoisotopic Mass | 252.07864 |
| SMILES | COc1ccc(C2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C16H12O3/c1-19-11-8-6-10(7-9-11)14-15(17)12-4-2-3-5-13(12)16(14)18/h2-9,14H,1H3 |
| InChIKey | XRCFXMGQEVUZFC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | vitamin K antagonist A class of anticoagulants which act by inhibiting the action of vitamin K. |
| Application: | anticoagulant An agent that prevents blood clotting. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| anisindione (CHEBI:133809) has parent hydride indane (CHEBI:37911) |
| anisindione (CHEBI:133809) has role anticoagulant (CHEBI:50249) |
| anisindione (CHEBI:133809) has role vitamin K antagonist (CHEBI:55347) |
| anisindione (CHEBI:133809) is a aromatic ketone (CHEBI:76224) |
| anisindione (CHEBI:133809) is a β-diketone (CHEBI:67265) |
| IUPAC Name |
|---|
| 2-(4-methoxyphenyl)-1H-indene-1,3(2H)-dione |
| INNs | Source |
|---|---|
| anisindione | KEGG DRUG |
| anisindiona | ChemIDplus |
| anisindionum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Anisin indandione | DrugBank |
| 2-(4-Methoxyphenyl)-1H-indene-1,3(2H)-dione | ChemIDplus |
| 2-(4-Methoxyphenyl)indan-1,3-dione | ChemIDplus |
| 2-(p-Methoxyphenyl)-1,3-indandione | ChemIDplus |
| 2-(p-Methoxyphenyl)indane-1,3-dione | ChemIDplus |
| 2-p-Anisyl-1,3-indandione | NIST Chemistry WebBook |