EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24O3 |
| Net Charge | 0 |
| Average Mass | 336.431 |
| Monoisotopic Mass | 336.17254 |
| SMILES | COC(=O)/C(C)=C(O)/C=C/C=C/C=C/C=C/C(C)=C/c1ccccc1 |
| InChI | InChI=1S/C22H24O3/c1-18(17-20-14-10-8-11-15-20)13-9-6-4-5-7-12-16-21(23)19(2)22(24)25-3/h4-17,23H,1-3H3/b6-4+,7-5+,13-9+,16-12+,18-17+,21-19- |
| InChIKey | SLSCKFUAPIQOND-BMJACRNQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus niger (ncbitaxon:5061) | mycelium (BTO:0001436) | Article (Phytochemistry, 1974, 13(3), 637-642) | 13 of 17 strains grown on a synthetic medium containing Zn2+ and Cd2+ in toxic concentrations and a high concentration of Mg2+ Strain: ATCC 9029 |
| Aspergillus niger ATCC 1015 (ncbitaxon:380704) | - | PubMed (26132344) |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asperrubrol (CHEBI:133808) has role Aspergillus metabolite (CHEBI:76956) |
| asperrubrol (CHEBI:133808) is a enoate ester (CHEBI:51702) |
| asperrubrol (CHEBI:133808) is a enol (CHEBI:33823) |
| asperrubrol (CHEBI:133808) is a methyl ester (CHEBI:25248) |
| IUPAC Name |
|---|
| methyl (2Z,4E,6E,8E,10E,12E)-3-hydroxy-2,12-dimethyl-13-phenyltrideca-2,4,6,8,10,12-hexaenoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:28417609 | Reaxys |
| CAS:31635-03-7 | ChemIDplus |
| Citations |
|---|