EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H18O9 |
| Net Charge | 0 |
| Average Mass | 414.366 |
| Monoisotopic Mass | 414.09508 |
| SMILES | COc1cc(O)c2c(c1)C=C1CC3(O)CC(O)=C(C(C)=O)C(=O)C3(O)C(O)=C1C2=O |
| InChI | InChI=1S/C21H18O9/c1-8(22)14-13(24)7-20(28)6-10-3-9-4-11(30-2)5-12(23)15(9)17(25)16(10)19(27)21(20,29)18(14)26/h3-5,23-24,27-29H,6-7H2,1-2H3 |
| InChIKey | CIWXXQSJBGNZNJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus niger (ncbitaxon:5061) | - | PubMed (7490207) | Strain: WB2346 |
| Roles Classification |
|---|
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . neuropeptide Y receptor antagonist An antagonist that binds to and deactivates neuropeptide Y receptors. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BMS-192548 (CHEBI:133806) has role Aspergillus metabolite (CHEBI:76956) |
| BMS-192548 (CHEBI:133806) has role neuropeptide Y receptor antagonist (CHEBI:133878) |
| BMS-192548 (CHEBI:133806) is a aromatic ether (CHEBI:35618) |
| BMS-192548 (CHEBI:133806) is a cyclic ketone (CHEBI:3992) |
| BMS-192548 (CHEBI:133806) is a enol (CHEBI:33823) |
| BMS-192548 (CHEBI:133806) is a enone (CHEBI:51689) |
| BMS-192548 (CHEBI:133806) is a methyl ketone (CHEBI:51867) |
| BMS-192548 (CHEBI:133806) is a phenols (CHEBI:33853) |
| BMS-192548 (CHEBI:133806) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| BMS-192548 (CHEBI:133806) is a tetracyclines (CHEBI:26895) |
| BMS-192548 (CHEBI:133806) is tautomer of TAN-1612 (CHEBI:133807) |
| Incoming Relation(s) |
| TAN-1612 (CHEBI:133807) is tautomer of BMS-192548 (CHEBI:133806) |
| IUPAC Name |
|---|
| 2-acetyl-3,4a,10,12,12a-pentahydroxy-8-methoxy-4a,12a-dihydrotetracene-1,11(4H,5H)-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7470148 | Reaxys |
| Citations |
|---|