EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H41O4 |
| Net Charge | -1 |
| Average Mass | 429.621 |
| Monoisotopic Mass | 429.30103 |
| SMILES | [H][C@]12CC[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CCCC(C)C(=O)[O-])[C@]1([H])[C@H](O)CC1=CC(=O)CC[C@@]12C |
| InChI | InChI=1S/C27H42O4/c1-16(6-5-7-17(2)25(30)31)20-8-9-21-24-22(11-13-27(20,21)4)26(3)12-10-19(28)14-18(26)15-23(24)29/h14,16-17,20-24,29H,5-13,15H2,1-4H3,(H,30,31)/p-1/t16-,17?,20-,21+,22+,23-,24+,26+,27-/m1/s1 |
| InChIKey | SATGKQGFUDXGAX-MYWFJNCASA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7α-hydroxy-3-oxo-4-cholestenoate (CHEBI:133803) is a steroid acid anion (CHEBI:50160) |
| 7α-hydroxy-3-oxo-4-cholestenoate (CHEBI:133803) is conjugate base of 7α-hydroxy-3-oxo-4-cholestenoic acid (CHEBI:83036) |
| Incoming Relation(s) |
| 7α-hydroxy-3-oxo-4-cholestenoic acid (CHEBI:83036) is conjugate acid of 7α-hydroxy-3-oxo-4-cholestenoate (CHEBI:133803) |
| IUPAC Name |
|---|
| 7α-hydroxy-3-oxocholest-4-en-26-oate |