EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O2 |
| Net Charge | 0 |
| Average Mass | 298.426 |
| Monoisotopic Mass | 298.19328 |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)O)C(C)(C)CC=C1 |
| InChI | InChI=1S/C20H26O2/c1-15(8-6-9-16(2)14-19(21)22)11-12-18-17(3)10-7-13-20(18,4)5/h6-12,14H,13H2,1-5H3,(H,21,22)/b9-6+,12-11+,15-8+,16-14+ |
| InChIKey | SYESMXTWOAQFET-YCNIQYBTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (24925226) | |
| Xenopus laevis (ncbitaxon:8355) | - | PubMed (7720529) |
| Roles Classification |
|---|
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| all-trans-3,4-didehydroretinoic acid (CHEBI:133794) has functional parent all-trans-retinoic acid (CHEBI:15367) |
| all-trans-3,4-didehydroretinoic acid (CHEBI:133794) has role human xenobiotic metabolite (CHEBI:76967) |
| all-trans-3,4-didehydroretinoic acid (CHEBI:133794) is a retinoid (CHEBI:26537) |
| all-trans-3,4-didehydroretinoic acid (CHEBI:133794) is a vitamin A (CHEBI:12777) |
| Synonyms | Source |
|---|---|
| 3,4-didehydroretinoic acid | ChemIDplus |
| didehydroretinoic acid | ChEBI |
| vitamin A2 acid | ChemIDplus |
| all-trans-3,4-didehydro-retinoic acid | LIPID MAPS |
| (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)nona-2,4,6,8-tetraenoic acid | IUPAC |
| Ro 8-7057 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LMPR01090020 | LIPID MAPS |
| HMDB0060092 | HMDB |
| 394417 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2136797 | Reaxys |
| CAS:4159-20-0 | ChemIDplus |
| Citations |
|---|