EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21NO4 |
| Net Charge | 0 |
| Average Mass | 303.358 |
| Monoisotopic Mass | 303.14706 |
| SMILES | CCCCC/C=C/C=C/c1oc2c(c(=O)c1O)C(=O)NC2C |
| InChI | InChI=1S/C17H21NO4/c1-3-4-5-6-7-8-9-10-12-14(19)15(20)13-16(22-12)11(2)18-17(13)21/h7-11,19H,3-6H2,1-2H3,(H,18,21)/b8-7+,10-9+ |
| InChIKey | LJYGSXTWVMUTEO-XBLVEGMJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus niger ATCC 1015 (ncbitaxon:380704) | - | PubMed (26414728) | Strain: AnKW2 |
| Roles Classification |
|---|
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyranonigrin K (CHEBI:133789) has role Aspergillus metabolite (CHEBI:76956) |
| pyranonigrin K (CHEBI:133789) has role marine metabolite (CHEBI:76507) |
| pyranonigrin K (CHEBI:133789) is a cyclic ketone (CHEBI:3992) |
| pyranonigrin K (CHEBI:133789) is a enol (CHEBI:33823) |
| pyranonigrin K (CHEBI:133789) is a pyranopyrrole (CHEBI:133874) |
| pyranonigrin K (CHEBI:133789) is a γ-lactam (CHEBI:74222) |
| IUPAC Name |
|---|
| 3-hydroxy-7-methyl-2-[(1E,3E)-nona-1,3-dien-1-yl]-6,7-dihydropyrano[2,3-c]pyrrole-4,5-dione |
| Citations |
|---|