EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18Cl2N2O4 |
| Net Charge | 0 |
| Average Mass | 373.236 |
| Monoisotopic Mass | 372.06436 |
| SMILES | CCOC(=O)C1=NN(c2ccc(Cl)cc2Cl)[C@](C)(C(=O)OCC)C1 |
| InChI | InChI=1S/C16H18Cl2N2O4/c1-4-23-14(21)12-9-16(3,15(22)24-5-2)20(19-12)13-7-6-10(17)8-11(13)18/h6-8H,4-5,9H2,1-3H3/t16-/m0/s1 |
| InChIKey | OPGCOAPTHCZZIW-INIZCTEOSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-mefenpyr-diethyl (CHEBI:133785) has functional parent (S)-mefenpyr (CHEBI:133766) |
| (S)-mefenpyr-diethyl (CHEBI:133785) is a dichlorobenzene (CHEBI:23697) |
| (S)-mefenpyr-diethyl (CHEBI:133785) is a diester (CHEBI:51307) |
| (S)-mefenpyr-diethyl (CHEBI:133785) is a ethyl ester (CHEBI:23990) |
| (S)-mefenpyr-diethyl (CHEBI:133785) is a pyrazoles (CHEBI:26410) |
| (S)-mefenpyr-diethyl (CHEBI:133785) is enantiomer of (R)-mefenpyr-diethyl (CHEBI:133784) |
| Incoming Relation(s) |
| mefenpyr-diethyl (CHEBI:133786) has part (S)-mefenpyr-diethyl (CHEBI:133785) |
| (R)-mefenpyr-diethyl (CHEBI:133784) is enantiomer of (S)-mefenpyr-diethyl (CHEBI:133785) |
| IUPAC Name |
|---|
| diethyl (5S)-1-(2,4-dichlorophenyl)-5-methyl-4,5-dihydro-1H-pyrazole-3,5-dicarboxylate |