EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H23NO4 |
| Net Charge | 0 |
| Average Mass | 305.374 |
| Monoisotopic Mass | 305.16271 |
| SMILES | CCCCC/C=C/C=C/C=C/C(O)=C1/C(=O)NC(CO)C1=O |
| InChI | InChI=1S/C17H23NO4/c1-2-3-4-5-6-7-8-9-10-11-14(20)15-16(21)13(12-19)18-17(15)22/h6-11,13,19-20H,2-5,12H2,1H3,(H,18,22)/b7-6+,9-8+,11-10+,15-14- |
| InChIKey | RUURYCUIDCAXSP-OSDNNVOJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus niger ATCC 1015 (ncbitaxon:380704) | - | PubMed (26414728) | Strain: AnKW2 |
| Roles Classification |
|---|
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyranonigrin J (CHEBI:133781) has role Aspergillus metabolite (CHEBI:76956) |
| pyranonigrin J (CHEBI:133781) has role marine metabolite (CHEBI:76507) |
| pyranonigrin J (CHEBI:133781) is a enol (CHEBI:33823) |
| pyranonigrin J (CHEBI:133781) is a primary alcohol (CHEBI:15734) |
| pyranonigrin J (CHEBI:133781) is a pyrrolidin-2-ones (CHEBI:74223) |
| IUPAC Name |
|---|
| (3Z)-3-[(2E,4E,6E)-1-hydroxydodeca-2,4,6-trien-1-ylidene]-5-(hydroxymethyl)pyrrolidine-2,4-dione |
| Citations |
|---|