EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H9NO5 |
| Net Charge | 0 |
| Average Mass | 223.184 |
| Monoisotopic Mass | 223.04807 |
| SMILES | C/C=C/c1oc2c(c(=O)c1O)C(=O)N[C@@H]2O |
| InChI | InChI=1S/C10H9NO5/c1-2-3-4-6(12)7(13)5-8(16-4)10(15)11-9(5)14/h2-3,10,12,15H,1H3,(H,11,14)/b3-2+/t10-/m1/s1 |
| InChIKey | OALBJWDVDNROSF-VMZHVLLKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus niger ATCC 1015 (ncbitaxon:380704) | - | PubMed (21543515) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyranonigrin A (CHEBI:133779) has role Aspergillus metabolite (CHEBI:76956) |
| pyranonigrin A (CHEBI:133779) has role antioxidant (CHEBI:22586) |
| pyranonigrin A (CHEBI:133779) has role marine metabolite (CHEBI:76507) |
| pyranonigrin A (CHEBI:133779) is a cyclic ketone (CHEBI:3992) |
| pyranonigrin A (CHEBI:133779) is a enol (CHEBI:33823) |
| pyranonigrin A (CHEBI:133779) is a pyranopyrrole (CHEBI:133874) |
| pyranonigrin A (CHEBI:133779) is a secondary alcohol (CHEBI:35681) |
| pyranonigrin A (CHEBI:133779) is a γ-lactam (CHEBI:74222) |
| IUPAC Name |
|---|
| (7R)-3,7-dihydroxy-2-[(1E)-prop-1-en-1-yl]-6,7-dihydropyrano[2,3-c]pyrrole-4,5-dione |
| Manual Xrefs | Databases |
|---|---|
| C00040123 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11195526 | Reaxys |
| CAS:773855-65-5 | KNApSAcK |
| Citations |
|---|