EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H10Cl2N2O4 |
| Net Charge | 0 |
| Average Mass | 317.128 |
| Monoisotopic Mass | 316.00176 |
| SMILES | C[C@]1(C(=O)O)CC(C(=O)O)=NN1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H10Cl2N2O4/c1-12(11(19)20)5-8(10(17)18)15-16(12)9-3-2-6(13)4-7(9)14/h2-4H,5H2,1H3,(H,17,18)(H,19,20)/t12-/m1/s1 |
| InChIKey | XEJNEDVTJPXRSM-GFCCVEGCSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-mefenpyr (CHEBI:133765) is a 1-(2,4-dichlorophenyl)-5-methyl-4,5-dihydro-1H-pyrazole-3,5-dicarboxylic acid (CHEBI:133764) |
| (R)-mefenpyr (CHEBI:133765) is enantiomer of (S)-mefenpyr (CHEBI:133766) |
| Incoming Relation(s) |
| (R)-mefenpyr-diethyl (CHEBI:133784) has functional parent (R)-mefenpyr (CHEBI:133765) |
| mefenpyr (CHEBI:133767) has part (R)-mefenpyr (CHEBI:133765) |
| (S)-mefenpyr (CHEBI:133766) is enantiomer of (R)-mefenpyr (CHEBI:133765) |
| IUPAC Name |
|---|
| (5R)-1-(2,4-dichlorophenyl)-5-methyl-4,5-dihydro-1H-pyrazole-3,5-dicarboxylic acid |