EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H26O10 |
| Net Charge | 0 |
| Average Mass | 570.550 |
| Monoisotopic Mass | 570.15260 |
| SMILES | COc1cc(OC)c2c(O)c3c(=O)cc(C)oc3c(-c3c(OC)cc4cc(O)c5c(=O)cc(C)oc5c4c3OC)c2c1 |
| InChI | InChI=1S/C32H26O10/c1-13-7-18(33)26-20(35)9-15-10-21(38-4)28(30(40-6)23(15)31(26)41-13)25-17-11-16(37-3)12-22(39-5)24(17)29(36)27-19(34)8-14(2)42-32(25)27/h7-12,35-36H,1-6H3 |
| InChIKey | FFNPXDMNZBCNMN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus aculeatus (ncbitaxon:5053) | - | PubMed (16155971) | |
| Aspergillus fonsecaeus | - | DOI (10.1016/S0040-4020(01)88792-5) | Strain: NRRL67 |
| Aspergillus niger ATCC 1015 (ncbitaxon:380704) | - | PubMed (21176790) | Strain: ATCC 11414 |
| Cladosporium herbarum (ncbitaxon:29918) | - | PubMed (16038560) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fonsecinone A (CHEBI:133759) has role Aspergillus metabolite (CHEBI:76956) |
| fonsecinone A (CHEBI:133759) has role antibacterial agent (CHEBI:33282) |
| fonsecinone A (CHEBI:133759) is a aromatic ether (CHEBI:35618) |
| fonsecinone A (CHEBI:133759) is a aromatic ketone (CHEBI:76224) |
| fonsecinone A (CHEBI:133759) is a biaryl (CHEBI:64459) |
| fonsecinone A (CHEBI:133759) is a cyclic ketone (CHEBI:3992) |
| fonsecinone A (CHEBI:133759) is a naphtho-γ-pyrone (CHEBI:64542) |
| fonsecinone A (CHEBI:133759) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 5-hydroxy-10-(5-hydroxy-8,10-dimethoxy-2-methyl-4-oxo-4H-naphtho[1,2-b]pyran-9-yl)-6,8-dimethoxy-2-methyl-4H-naphtho[2,3-b]pyran-4-one |
| Citations |
|---|