EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H21N3O5 |
| Net Charge | 0 |
| Average Mass | 275.305 |
| Monoisotopic Mass | 275.14812 |
| SMILES | [NH3+][C@@H](CCCCNC(=O)CC[C@H]([NH3+])C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C11H21N3O5/c12-7(10(16)17)3-1-2-6-14-9(15)5-4-8(13)11(18)19/h7-8H,1-6,12-13H2,(H,14,15)(H,16,17)(H,18,19)/t7-,8-/m0/s1 |
| InChIKey | JPKNLFVGUZRHOB-YUMQZZPRSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ε-(γ-glutamyl)lysine dizwitterion (CHEBI:133752) is a L-α-amino acid zwitterion (CHEBI:59869) |
| ε-(γ-glutamyl)lysine dizwitterion (CHEBI:133752) is tautomer of ε-(γ-glutamyl)lysine (CHEBI:88494) |
| Incoming Relation(s) |
| ε-(γ-glutamyl)lysine (CHEBI:88494) is tautomer of ε-(γ-glutamyl)lysine dizwitterion (CHEBI:133752) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-6-{[(4S)-4-azaniumyl-4-carboxylatobutanoyl]amino}hexanoate |
| Synonyms | Source |
|---|---|
| L-γ-glutamyl-L-ε-lysine dizwitterion | ChEBI |
| γ-glutamyl-ε-lysine dizwitterion | ChEBI |
| γ-Glu-ε-Lys dizwitterion | ChEBI |
| ε-(L-γ-glutamyl)-L-lysine dizwitterion | ChEBI |
| UniProt Name | Source |
|---|---|
| ε-(γ-L-glutamyl)-L-lysine | UniProt |