EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H19N2O2P |
| Net Charge | 0 |
| Average Mass | 362.369 |
| Monoisotopic Mass | 362.11841 |
| SMILES | NC(=O)NC(=O)C=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H19N2O2P/c22-21(25)23-20(24)16-26(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-16H,(H3,22,23,24,25) |
| InChIKey | HIFJFZSMVLIPEA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.3.1.85 (fatty acid synthase) inhibitor An EC 2.3.1.* (acyltransferase transferring other than amino-acyl group) inhibitor that interferes with the action of fatty acid synthase (EC 2.3.1.85), a multi-enzyme protein involved in fatty acid synthesis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cutin-1 (CHEBI:133750) has role EC 2.3.1.85 (fatty acid synthase) inhibitor (CHEBI:71476) |
| Cutin-1 (CHEBI:133750) is a N-acylurea (CHEBI:74266) |
| Cutin-1 (CHEBI:133750) is a phosphonium ylide (CHEBI:51154) |
| IUPAC Names |
|---|
| 2-(triphenyl-λ5-phosphanylidene)acetamide |
| N-carbamoyl-2-(triphenylphosphoranylidene)acetamide |
| Synonyms | Source |
|---|---|
| triphenylphosphonium(carbamoylcarbamoyl)methylylid | ChEBI |
| ureidocarbomethylentriphenylphosphoniumylid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2765280 | Reaxys |
| CAS:53296-08-5 | ChEBI |
| Citations |
|---|