EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20O4S |
| Net Charge | 0 |
| Average Mass | 260.355 |
| Monoisotopic Mass | 260.10823 |
| SMILES | CCCCCCc1oc(CC)cc1S(=O)(=O)O |
| InChI | InChI=1S/C12H20O4S/c1-3-5-6-7-8-11-12(17(13,14)15)9-10(4-2)16-11/h9H,3-8H2,1-2H3,(H,13,14,15) |
| InChIKey | ONSMNPXHEJVOQJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lumbricus rubellus (ncbitaxon:35632) | - | PubMed (26241769) |
| Roles Classification |
|---|
| Biological Role: | nematode metabolite An animal metabolite produced by any member of the phylum Nematoda. |
| Application: | protective agent Synthetic or natural substance which is given to prevent a disease or disorder or are used in the process of treating a disease or injury due to a poisonous agent. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| drilodefensin 1 (CHEBI:133749) has role nematode metabolite (CHEBI:78803) |
| drilodefensin 1 (CHEBI:133749) has role protective agent (CHEBI:50267) |
| drilodefensin 1 (CHEBI:133749) is a arenesulfonic acid (CHEBI:33555) |
| drilodefensin 1 (CHEBI:133749) is a furans (CHEBI:24129) |
| IUPAC Name |
|---|
| 5-ethyl-2-hexylfuran-3-sulfonic acid |
| Synonyms | Source |
|---|---|
| 5-ethyl-2-hexyl-3-sulfofuran | ChEBI |
| HEFS | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| Drilodefensins | Wikipedia |
| Citations |
|---|