EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H13N2O3 |
| Net Charge | -1 |
| Average Mass | 245.258 |
| Monoisotopic Mass | 245.09317 |
| SMILES | CC(=O)NC(Cc1cnc2ccccc12)C(=O)[O-] |
| InChI | InChI=1S/C13H14N2O3/c1-8(16)15-12(13(17)18)6-9-7-14-11-5-3-2-4-10(9)11/h2-5,7,12,14H,6H2,1H3,(H,15,16)(H,17,18)/p-1 |
| InChIKey | DZTHIGRZJZPRDV-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyltryptophanate (CHEBI:133746) has role metabolite (CHEBI:25212) |
| N-acetyltryptophanate (CHEBI:133746) is a monocarboxylic acid anion (CHEBI:35757) |
| N-acetyltryptophanate (CHEBI:133746) is conjugate base of N-acetyltryptophan (CHEBI:70976) |
| Incoming Relation(s) |
| N-acetyltryptophan (CHEBI:70976) is conjugate acid of N-acetyltryptophanate (CHEBI:133746) |
| IUPAC Name |
|---|
| 2-acetamido-3-(1H-indol-3-yl)propanoate |
| Synonyms | Source |
|---|---|
| acetyltryptophan(1−) | ChEBI |
| acetyltryptophanate | ChEBI |
| N-acetyltryptophan(1−) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5294451 | Reaxys |