EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H19N2O5 |
| Net Charge | -1 |
| Average Mass | 259.282 |
| Monoisotopic Mass | 259.12995 |
| SMILES | CC[C@H](C)[C@H](NC(=O)CC[C@H]([NH3+])C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C11H20N2O5/c1-3-6(2)9(11(17)18)13-8(14)5-4-7(12)10(15)16/h6-7,9H,3-5,12H2,1-2H3,(H,13,14)(H,15,16)(H,17,18)/p-1/t6-,7-,9-/m0/s1 |
| InChIKey | SNCKGJWJABDZHI-ZKWXMUAHSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-Glu-Ile(1−) (CHEBI:133724) is a peptide anion (CHEBI:60334) |
| γ-Glu-Ile(1−) (CHEBI:133724) is conjugate base of γ-Glu-Ile (CHEBI:68434) |
| Incoming Relation(s) |
| γ-Glu-Ile (CHEBI:68434) is conjugate acid of γ-Glu-Ile(1−) (CHEBI:133724) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-5-{[(1S,2S)-1-carboxylato-2-methylbutyl]amino}-5-oxopentanoate |
| Synonyms | Source |
|---|---|
| L-γ-glutamyl-L-isoleucinate(1−) | ChEBI |
| γ-glutamylisoleucinate(1−) | ChEBI |