EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:133721 - rhamnacene
| Formula | C17H14O7 |
| Net Charge | 0 |
| Average Mass | 330.292 |
| Monoisotopic Mass | 330.07395 |
| SMILES | COc1cc(O)c2c(=O)c(O)c(-c3ccc(O)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C17H14O7/c1-22-9-6-11(19)14-13(7-9)24-17(16(21)15(14)20)8-3-4-10(18)12(5-8)23-2/h3-7,18-19,21H,1-2H3 |
| InChIKey | MYMGKIQXYXSRIJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rhamnus petiolaris (IPNI:718561-1) | - | Article (Phytochemistry, 1974, 13(5), 857-860.) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rhamnacene (CHEBI:133721) has functional parent quercetin (CHEBI:16243) |
| rhamnacene (CHEBI:133721) has role antineoplastic agent (CHEBI:35610) |
| rhamnacene (CHEBI:133721) has role plant metabolite (CHEBI:76924) |
| rhamnacene (CHEBI:133721) is a aromatic ether (CHEBI:35618) |
| rhamnacene (CHEBI:133721) is a dimethoxyflavone (CHEBI:23798) |
| rhamnacene (CHEBI:133721) is a phenols (CHEBI:33853) |
| rhamnacene (CHEBI:133721) is a trihydroxyflavone (CHEBI:27116) |
| rhamnacene (CHEBI:133721) is conjugate acid of rhamnacene-3-olate (CHEBI:192768) |
| Incoming Relation(s) |
| viscumneoside IV (CHEBI:132858) has functional parent rhamnacene (CHEBI:133721) |
| viscumneoside VII (CHEBI:132861) has functional parent rhamnacene (CHEBI:133721) |
| rhamnacene-3-olate (CHEBI:192768) is conjugate base of rhamnacene (CHEBI:133721) |
| IUPAC Name |
|---|
| 3,5-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-methoxy-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 3,5,4'-trihydroxy-7,3'-dimethoxyflavone | ChEBI |
| 3',7-dimethylquercetin | ChemIDplus |
| rhamnazin | ChEBI |
| Citations |
|---|