EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13NO5S |
| Net Charge | 0 |
| Average Mass | 247.272 |
| Monoisotopic Mass | 247.05144 |
| SMILES | COc1cc(CC[NH3+])ccc1OS(=O)(=O)[O-] |
| InChI | InChI=1S/C9H13NO5S/c1-14-9-6-7(4-5-10)2-3-8(9)15-16(11,12)13/h2-3,6H,4-5,10H2,1H3,(H,11,12,13) |
| InChIKey | ORZHQEJEAKXCJA-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methoxytyramine sulfate zwitterion (CHEBI:133709) is a zwitterion (CHEBI:27369) |
| 3-methoxytyramine sulfate zwitterion (CHEBI:133709) is tautomer of 3-methoxytyramine sulfate (CHEBI:133708) |
| Incoming Relation(s) |
| 3-methoxytyramine sulfate (CHEBI:133708) is tautomer of 3-methoxytyramine sulfate zwitterion (CHEBI:133709) |
| IUPAC Name |
|---|
| 4-(2-azaniumylethyl)-2-methoxyphenyl sulfate |