EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H24N4O3 |
| Net Charge | 0 |
| Average Mass | 452.514 |
| Monoisotopic Mass | 452.18484 |
| SMILES | CN[C@@H]1C[C@H]2O[C@@](C)([C@@H]1O)n1c3ccccc3c3c4c(c5c6ccccc6n2c5c31)C(=O)NC4 |
| InChI | InChI=1S/C27H24N4O3/c1-27-25(32)16(28-2)11-19(34-27)30-17-9-5-3-7-13(17)21-22-15(12-29-26(22)33)20-14-8-4-6-10-18(14)31(27)24(20)23(21)30/h3-10,16,19,25,28,32H,11-12H2,1-2H3,(H,29,33)/t16-,19-,25-,27+/m1/s1 |
| InChIKey | YFYYWLWHOINTHH-FCHZLITKSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3'-demethylstaurosporine (CHEBI:15692) has functional parent staurosporine (CHEBI:15738) |
| 3'-demethylstaurosporine (CHEBI:15692) is a indolocarbazole alkaloid (CHEBI:37697) |
| 3'-demethylstaurosporine (CHEBI:15692) is conjugate base of 3'-demethylstaurosporinium(1+) (CHEBI:57473) |
| Incoming Relation(s) |
| 3'-demethylstaurosporinium(1+) (CHEBI:57473) is conjugate acid of 3'-demethylstaurosporine (CHEBI:15692) |
| IUPAC Name |
|---|
| (5S,6R,7R,9R)-6-hydroxy-5-methyl-7-methylamino-6,7,8,9,15,16-hexahydro-5H,14H-5,9-epoxy-4b,9a,15-triazadibenzo[b,h]cyclonona[1,2,3,4-jkl]cyclopenta[e]-as-indacen-14-one |
| Synonym | Source |
|---|---|
| 3'-Demethylstaurosporine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C07349 | KEGG COMPOUND |