EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11BrN2O2 |
| Net Charge | 0 |
| Average Mass | 283.125 |
| Monoisotopic Mass | 282.00039 |
| SMILES | NC(Cc1cnc2ccc(Br)cc12)C(=O)O |
| InChI | InChI=1S/C11H11BrN2O2/c12-7-1-2-10-8(4-7)6(5-14-10)3-9(13)11(15)16/h1-2,4-5,9,14H,3,13H2,(H,15,16) |
| InChIKey | KZDNJQUJBMDHJW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-bromotryptophan (CHEBI:133686) is a bromoamino acid (CHEBI:22930) |
| 5-bromotryptophan (CHEBI:133686) is a bromoindole (CHEBI:52514) |
| 5-bromotryptophan (CHEBI:133686) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| 5-bromotryptophan (CHEBI:133686) is a tryptophan derivative (CHEBI:27164) |
| 5-bromotryptophan (CHEBI:133686) is tautomer of 5-bromotryptophan zwitterion (CHEBI:133688) |
| Incoming Relation(s) |
| 5-bromotryptophan zwitterion (CHEBI:133688) is tautomer of 5-bromotryptophan (CHEBI:133686) |
| IUPAC Name |
|---|
| 5-bromotryptophan |
| Synonym | Source |
|---|---|
| 2-amino-3-(5-bromo-1H-indol-3-yl)propanoic acid | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5280904 | Reaxys |
| CAS:6548-09-0 | ChemIDplus |