EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H11NS |
| Net Charge | 0 |
| Average Mass | 141.239 |
| Monoisotopic Mass | 141.06122 |
| SMILES | CC(C)Cc1nccs1 |
| InChI | InChI=1S/C7H11NS/c1-6(2)5-7-8-3-4-9-7/h3-4,6H,5H2,1-2H3 |
| InChIKey | CMPVUVUNJQERIT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cephalophus natalensis (ncbitaxon:69299) | - | PubMed (3245266) | Found in preorbital gland secretions |
| Sylvicapra grimmia (ncbitaxon:119562) | - | PubMed (3245266) | Found in preorbital gland secretions |
| Roles Classification |
|---|
| Chemical Roles: | Maillard reaction product Any thermal degradation product obtained as a result of a chemical reaction between an amino acid and a reducing sugar (Maillard reaction, a non-enzymatic browning procedure that usually imparts flavour to starch-based food products). flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-isobutylthiazole (CHEBI:133683) has role flavouring agent (CHEBI:35617) |
| 2-isobutylthiazole (CHEBI:133683) has role Maillard reaction product (CHEBI:77523) |
| 2-isobutylthiazole (CHEBI:133683) has role pheromone (CHEBI:26013) |
| 2-isobutylthiazole (CHEBI:133683) is a 1,3-thiazoles (CHEBI:38418) |
| IUPAC Name |
|---|
| 2-isobutyl-1,3-thiazole |
| Synonyms | Source |
|---|---|
| 2-(2-methylpropyl)-1,3-thiazole | NIST Chemistry WebBook |
| 2-(2-methylpropyl)thiazole | ChemIDplus |
| FEMA 3134 | ChEBI |
| FEMA No. 3134 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0031862 | HMDB |
| YMDB01585 | YMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:507823 | Reaxys |
| CAS:18640-74-9 | ChemIDplus |
| CAS:18640-74-9 | NIST Chemistry WebBook |
| Citations |
|---|