EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9O4S |
| Net Charge | -1 |
| Average Mass | 201.223 |
| Monoisotopic Mass | 201.02270 |
| SMILES | CCc1ccc(OS(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C8H10O4S/c1-2-7-3-5-8(6-4-7)12-13(9,10)11/h3-6H,2H2,1H3,(H,9,10,11)/p-1 |
| InChIKey | DWZGLEPNCRFCEP-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Roles: | uremic toxin A toxin that accumulates in patients with chronic kidney disease. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). gut flora metabolite Metabolites produced by the gut microbiota or microorganisms (e.g. bacteria and fungi) that live in the digestive tracts of animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-ethylphenyl sulfate(1−) (CHEBI:133681) has role gut flora metabolite (CHEBI:82933) |
| 4-ethylphenyl sulfate(1−) (CHEBI:133681) has role human metabolite (CHEBI:77746) |
| 4-ethylphenyl sulfate(1−) (CHEBI:133681) has role uremic toxin (CHEBI:64584) |
| 4-ethylphenyl sulfate(1−) (CHEBI:133681) is a phenyl sulfate oxoanion (CHEBI:140317) |
| 4-ethylphenyl sulfate(1−) (CHEBI:133681) is conjugate base of 4-ethylphenyl sulfate (CHEBI:82932) |
| Incoming Relation(s) |
| 4-ethylphenyl sulfate (CHEBI:82932) is conjugate acid of 4-ethylphenyl sulfate(1−) (CHEBI:133681) |
| IUPAC Name |
|---|
| 4-ethylphenyl sulfate |
| Synonyms | Source |
|---|---|
| para-ethylphenyl sulfate(1−) | ChEBI |
| p-ethylphenyl sulfate(1−) | ChEBI |
| UniProt Name | Source |
|---|---|
| 4-ethylphenyl sulfate | UniProt |