EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9O4S |
| Net Charge | -1 |
| Average Mass | 201.223 |
| Monoisotopic Mass | 201.02270 |
| SMILES | CCc1ccc(OS(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C8H10O4S/c1-2-7-3-5-8(6-4-7)12-13(9,10)11/h3-6H,2H2,1H3,(H,9,10,11)/p-1 |
| InChIKey | DWZGLEPNCRFCEP-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). uremic toxin A toxin that accumulates in patients with chronic kidney disease. gut flora metabolite Metabolites produced by the gut microbiota or microorganisms (e.g. bacteria and fungi) that live in the digestive tracts of animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-ethylphenyl sulfate(1−) (CHEBI:133681) has role gut flora metabolite (CHEBI:82933) |
| 4-ethylphenyl sulfate(1−) (CHEBI:133681) has role human metabolite (CHEBI:77746) |
| 4-ethylphenyl sulfate(1−) (CHEBI:133681) has role uremic toxin (CHEBI:64584) |
| 4-ethylphenyl sulfate(1−) (CHEBI:133681) is a phenyl sulfate oxoanion (CHEBI:140317) |
| 4-ethylphenyl sulfate(1−) (CHEBI:133681) is conjugate base of 4-ethylphenyl sulfate (CHEBI:82932) |
| Incoming Relation(s) |
| 4-ethylphenyl sulfate (CHEBI:82932) is conjugate acid of 4-ethylphenyl sulfate(1−) (CHEBI:133681) |
| IUPAC Name |
|---|
| 4-ethylphenyl sulfate |
| Synonyms | Source |
|---|---|
| para-ethylphenyl sulfate(1−) | ChEBI |
| p-ethylphenyl sulfate(1−) | ChEBI |
| UniProt Name | Source |
|---|---|
| 4-ethylphenyl sulfate | UniProt |