EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H7O4S |
| Net Charge | -1 |
| Average Mass | 199.207 |
| Monoisotopic Mass | 199.00705 |
| SMILES | C=Cc1ccc(OS(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C8H8O4S/c1-2-7-3-5-8(6-4-7)12-13(9,10)11/h2-6H,1H2,(H,9,10,11)/p-1 |
| InChIKey | IETVQHUKTKKBFF-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-vinylphenol sulfate(1−) (CHEBI:133676) has role human xenobiotic metabolite (CHEBI:76967) |
| 4-vinylphenol sulfate(1−) (CHEBI:133676) is a phenyl sulfate oxoanion (CHEBI:140317) |
| 4-vinylphenol sulfate(1−) (CHEBI:133676) is conjugate base of 4-vinylphenol sulfate (CHEBI:82931) |
| Incoming Relation(s) |
| 4-vinylphenol sulfate (CHEBI:82931) is conjugate acid of 4-vinylphenol sulfate(1−) (CHEBI:133676) |
| IUPAC Name |
|---|
| 4-ethenylphenyl sulfate |
| Synonyms | Source |
|---|---|
| p-vinylphenyl sulfate(1−) | ChEBI |
| para-vinylphenyl sulfate(1−) | ChEBI |
| p-vinylphenol sulfate(1−) | ChEBI |
| 4-vinylphenyl sulfate(1−) | ChEBI |
| para-vinylphenol sulfate(1−) | ChEBI |