EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H7NO5P |
| Net Charge | -1 |
| Average Mass | 168.065 |
| Monoisotopic Mass | 168.00673 |
| SMILES | O=C([O-])C[NH2+]CP(=O)([O-])O |
| InChI | InChI=1S/C3H8NO5P/c5-3(6)1-4-2-10(7,8)9/h4H,1-2H2,(H,5,6)(H2,7,8,9)/p-1 |
| InChIKey | XDDAORKBJWWYJS-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glyphosate(1−) (CHEBI:133673) is a organophosphate oxoanion (CHEBI:58945) |
| glyphosate(1−) (CHEBI:133673) is conjugate acid of glyphosate(2−) (CHEBI:67052) |
| glyphosate(1−) (CHEBI:133673) is conjugate base of glyphosate (CHEBI:27744) |
| Incoming Relation(s) |
| glyphosate (CHEBI:27744) is conjugate acid of glyphosate(1−) (CHEBI:133673) |
| glyphosate(2−) (CHEBI:67052) is conjugate base of glyphosate(1−) (CHEBI:133673) |
| UniProt Name | Source |
|---|---|
| glyphosate | UniProt |