EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H7O4S |
| Net Charge | -1 |
| Average Mass | 187.196 |
| Monoisotopic Mass | 187.00705 |
| SMILES | Cc1ccc(OS(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C7H8O4S/c1-6-2-4-7(5-3-6)11-12(8,9)10/h2-5H,1H3,(H,8,9,10)/p-1 |
| InChIKey | WGNAKZGUSRVWRH-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). uremic toxin A toxin that accumulates in patients with chronic kidney disease. gut flora metabolite Metabolites produced by the gut microbiota or microorganisms (e.g. bacteria and fungi) that live in the digestive tracts of animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| p-cresol sulfate(1−) (CHEBI:133670) has role gut flora metabolite (CHEBI:82933) |
| p-cresol sulfate(1−) (CHEBI:133670) has role human metabolite (CHEBI:77746) |
| p-cresol sulfate(1−) (CHEBI:133670) has role uremic toxin (CHEBI:64584) |
| p-cresol sulfate(1−) (CHEBI:133670) is a phenyl sulfate oxoanion (CHEBI:140317) |
| p-cresol sulfate(1−) (CHEBI:133670) is conjugate base of p-cresol sulfate (CHEBI:82914) |
| Incoming Relation(s) |
| p-cresol sulfate (CHEBI:82914) is conjugate acid of p-cresol sulfate(1−) (CHEBI:133670) |
| IUPAC Name |
|---|
| 4-methylphenyl sulfate |
| Synonyms | Source |
|---|---|
| 4-tolyl sulfate(1−) | ChEBI |
| para-cresol sulfate(1−) | ChEBI |
| para-cresyl sulfate(1−) | ChEBI |
| para-tolyl sulfate(1−) | ChEBI |
| p-cresol sulfate | ChEBI |
| p-cresyl sulfate(1−) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3668793 | Reaxys |