EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:133670 - p-cresol sulfate(1−)
| Formula | C7H7O4S |
| Net Charge | -1 |
| Average Mass | 187.196 |
| Monoisotopic Mass | 187.00705 |
| SMILES | Cc1ccc(OS(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C7H8O4S/c1-6-2-4-7(5-3-6)11-12(8,9)10/h2-5H,1H3,(H,8,9,10)/p-1 |
| InChIKey | WGNAKZGUSRVWRH-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Roles: | uremic toxin A toxin that accumulates in patients with chronic kidney disease. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). gut flora metabolite Metabolites produced by the gut microbiota or microorganisms (e.g. bacteria and fungi) that live in the digestive tracts of animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| p-cresol sulfate(1−) (CHEBI:133670) has role gut flora metabolite (CHEBI:82933) |
| p-cresol sulfate(1−) (CHEBI:133670) has role human metabolite (CHEBI:77746) |
| p-cresol sulfate(1−) (CHEBI:133670) has role uremic toxin (CHEBI:64584) |
| p-cresol sulfate(1−) (CHEBI:133670) is a phenyl sulfate oxoanion (CHEBI:140317) |
| p-cresol sulfate(1−) (CHEBI:133670) is conjugate base of p-cresol sulfate (CHEBI:82914) |
| Incoming Relation(s) |
| p-cresol sulfate (CHEBI:82914) is conjugate acid of p-cresol sulfate(1−) (CHEBI:133670) |
| IUPAC Name |
|---|
| 4-methylphenyl sulfate |
| Synonyms | Source |
|---|---|
| p-cresol sulfate | ChEBI |
| para-cresol sulfate(1−) | ChEBI |
| p-cresyl sulfate(1−) | ChEBI |
| 4-tolyl sulfate(1−) | ChEBI |
| p-tolyl sulfate(1−) | ChEBI |
| para-tolyl sulfate(1−) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3668793 | Reaxys |