EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14N2O3 |
| Net Charge | 0 |
| Average Mass | 186.211 |
| Monoisotopic Mass | 186.10044 |
| SMILES | C[C@H](NC(=O)[C@@H]1CCC[NH2+]1)C(=O)[O-] |
| InChI | InChI=1S/C8H14N2O3/c1-5(8(12)13)10-7(11)6-3-2-4-9-6/h5-6,9H,2-4H2,1H3,(H,10,11)(H,12,13)/t5-,6-/m0/s1 |
| InChIKey | FELJDCNGZFDUNR-WDSKDSINSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pro-Ala zwitterion (CHEBI:133659) has role metabolite (CHEBI:25212) |
| Pro-Ala zwitterion (CHEBI:133659) is a dipeptide zwitterion (CHEBI:90799) |
| Pro-Ala zwitterion (CHEBI:133659) is tautomer of Pro-Ala (CHEBI:74753) |
| Incoming Relation(s) |
| Pro-Ala (CHEBI:74753) is tautomer of Pro-Ala zwitterion (CHEBI:133659) |
| IUPAC Name |
|---|
| (2S)-2-{[(2S)-pyrrolidin-1-ium-2-carbonyl]amino}propanoate |
| Synonyms | Source |
|---|---|
| PA zwitterion | ChEBI |
| prolylalanine zwitterion | ChEBI |
| L-prolyl-L-alanine zwitterion | ChEBI |
| L-Pro-L-Ala zwitterion | ChEBI |