EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11NO4 |
| Net Charge | 0 |
| Average Mass | 149.146 |
| Monoisotopic Mass | 149.06881 |
| SMILES | NC1OC[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C5H11NO4/c6-5-4(9)3(8)2(7)1-10-5/h2-5,7-9H,1,6H2/t2-,3+,4+,5?/m1/s1 |
| InChIKey | RQBSUMJKSOSGJJ-AGQMPKSLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | MetaboLights (MTBLS129) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-lyxosylamine (CHEBI:133632) has functional parent D-lyxopyranose (CHEBI:82838) |
| D-lyxosylamine (CHEBI:133632) has role plant metabolite (CHEBI:76924) |
| D-lyxosylamine (CHEBI:133632) is a hexosamine (CHEBI:24586) |
| IUPAC Name |
|---|
| D-lyxopyranosylamine |
| Synonym | Source |
|---|---|
| 1-amino-1-deoxy-D-lyxose | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7345803 | Reaxys |