EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H38N4O4 |
| Net Charge | 0 |
| Average Mass | 566.702 |
| Monoisotopic Mass | 566.28931 |
| SMILES | CCC1=C(C)c2cc3nc(cc4nc(cc5nc(cc1n2)c(C)c5CCC(=O)O)C(CCC(=O)O)=C4C)c(C)c3CC |
| InChI | InChI=1S/C34H38N4O4/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25/h13-16,35,38H,7-12H2,1-6H3,(H,39,40)(H,41,42)/b25-13-,26-13-,27-14-,28-15-,29-14-,30-15-,31-16-,32-16- |
| InChIKey | UQVVDGKMSUMXBI-UJJXFSCMSA-N |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mesoporphyrin IX (CHEBI:133626) is a mesoporphyrins (CHEBI:59559) |
| IUPAC Name |
|---|
| 3,3'-(7,12-diethyl-3,8,13,17-tetramethylporphyrin-2,18-diyl)dipropanoic acid |
| Synonyms | Source |
|---|---|
| 7,12-Diethyl-3,8,13,17-tetramethyl-2,18-porphinedipropionic acid | HMDB |
| 7,12-Diethyl-3,8,13,17-tetramethyl-21H,23H-porphine-2,18-dipropanoic acid | HMDB |
| MPIX | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0002379 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:381064 | Reaxys |
| Reaxys:601056 | Reaxys |
| CAS:493-90-3 | ChemIDplus |
| Citations |
|---|