EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H15ClS |
| Net Charge | 0 |
| Average Mass | 346.882 |
| Monoisotopic Mass | 346.05830 |
| SMILES | Clc1ccc(-c2cc(-c3ccccc3)c(-c3ccccc3)s2)cc1 |
| InChI | InChI=1S/C22H15ClS/c23-19-13-11-17(12-14-19)21-15-20(16-7-3-1-4-8-16)22(24-21)18-9-5-2-6-10-18/h1-15H |
| InChIKey | JWXZLCFGVKMEEK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triarathene (CHEBI:133619) has role acaricide (CHEBI:22153) |
| triarathene (CHEBI:133619) has role insecticide (CHEBI:24852) |
| triarathene (CHEBI:133619) is a monochlorobenzenes (CHEBI:83403) |
| triarathene (CHEBI:133619) is a thiophenes (CHEBI:26961) |
| IUPAC Name |
|---|
| 5-(4-chlorophenyl)-2,3-diphenylthiophene |
| Synonyms | Source |
|---|---|
| 5-(p-chlorophenyl)-2,3-diphenylthiophene | ChEBI |
| 2,3-diphenyl-5-p-chlorophenyl thiophene | ChemIDplus |
| triarathène | ChEBI |
| T-930 | ChemIDplus |
| UBI-T930 | ChEBI |
| UBIT930 | ChEBI |
| Brand Name | Source |
|---|---|
| Micromite | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| triarathene | Alan Wood's Pesticides |
| 2859 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13257581 | Reaxys |
| CAS:65691-00-1 | Alan Wood's Pesticides |
| CAS:65691-00-1 | ChemIDplus |
| Citations |
|---|