EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14N2O3 |
| Net Charge | 0 |
| Average Mass | 174.200 |
| Monoisotopic Mass | 174.10044 |
| SMILES | CC(C)[C@H]([NH3+])C(=O)NCC(=O)[O-] |
| InChI | InChI=1S/C7H14N2O3/c1-4(2)6(8)7(12)9-3-5(10)11/h4,6H,3,8H2,1-2H3,(H,9,12)(H,10,11)/t6-/m0/s1 |
| InChIKey | IOUPEELXVYPCPG-LURJTMIESA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Val-Gly zwitterion (CHEBI:133616) has role metabolite (CHEBI:25212) |
| Val-Gly zwitterion (CHEBI:133616) is a dipeptide zwitterion (CHEBI:90799) |
| Val-Gly zwitterion (CHEBI:133616) is tautomer of Val-Gly (CHEBI:73699) |
| Incoming Relation(s) |
| Val-Gly (CHEBI:73699) is tautomer of Val-Gly zwitterion (CHEBI:133616) |
| IUPAC Name |
|---|
| {[(2S)-2-azaniumyl-3-methylbutanoyl]amino}acetate |
| Synonyms | Source |
|---|---|
| L-Val-Gly zwitterion | ChEBI |
| L-valylglycine zwitterion | ChEBI |
| valylglycine zwitterion | ChEBI |
| V-G zwitterion | ChEBI |