EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12NO4 |
| Net Charge | -1 |
| Average Mass | 222.220 |
| Monoisotopic Mass | 222.07718 |
| SMILES | CC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)[O-] |
| InChI | InChI=1S/C11H13NO4/c1-7(13)12-10(11(15)16)6-8-2-4-9(14)5-3-8/h2-5,10,14H,6H2,1H3,(H,12,13)(H,15,16)/p-1/t10-/m0/s1 |
| InChIKey | CAHKINHBCWCHCF-JTQLQIEISA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-L-tyrosinate (CHEBI:133591) is a N-acyl-L-α-amino acid anion (CHEBI:59874) |
| N-acetyl-L-tyrosinate (CHEBI:133591) is a monocarboxylic acid anion (CHEBI:35757) |
| N-acetyl-L-tyrosinate (CHEBI:133591) is conjugate base of N-acetyl-L-tyrosine (CHEBI:21563) |
| Incoming Relation(s) |
| N-acetyl-L-tyrosine (CHEBI:21563) is conjugate acid of N-acetyl-L-tyrosinate (CHEBI:133591) |
| IUPAC Name |
|---|
| (2S)-2-acetamido-3-(4-hydroxyphenyl)propanoate |
| Synonyms | Source |
|---|---|
| N-acetyl-L-tyrosine(1−) | ChEBI |
| N-acetyltyrosinate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5962220 | Reaxys |