EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H6NO4S |
| Net Charge | -1 |
| Average Mass | 212.206 |
| Monoisotopic Mass | 212.00230 |
| SMILES | O=S(=O)([O-])Oc1ccc2ccnc2c1 |
| InChI | InChI=1S/C8H7NO4S/c10-14(11,12)13-7-2-1-6-3-4-9-8(6)5-7/h1-5,9H,(H,10,11,12)/p-1 |
| InChIKey | QRHHXPIYYXPEMG-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-hydroxyindole sulfate(1−) (CHEBI:133569) is a aryl sulfate oxoanion (CHEBI:139371) |
| 6-hydroxyindole sulfate(1−) (CHEBI:133569) is conjugate base of 6-hydroxyindole sulfate (CHEBI:133568) |
| Incoming Relation(s) |
| 6-hydroxyindole sulfate (CHEBI:133568) is conjugate acid of 6-hydroxyindole sulfate(1−) (CHEBI:133569) |