EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H15O8 |
| Net Charge | -1 |
| Average Mass | 335.288 |
| Monoisotopic Mass | 335.07724 |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)O[C@@H]1CC(C(=O)[O-])=C[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H16O8/c17-10-3-1-8(5-11(10)18)2-4-14(20)24-13-7-9(16(22)23)6-12(19)15(13)21/h1-6,12-13,15,17-19,21H,7H2,(H,22,23)/p-1/b4-2+/t12-,13-,15-/m1/s1 |
| InChIKey | QMPHZIPNNJOWQI-GDDAOPKQSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | MetaboLights (MTBLS129) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-[(E)-caffeoyl]shikimate (CHEBI:91005) has role plant metabolite (CHEBI:76924) |
| 5-[(E)-caffeoyl]shikimate (CHEBI:91005) is a cyclohexenecarboxylate (CHEBI:36126) |
| 5-[(E)-caffeoyl]shikimate (CHEBI:91005) is a hydroxy monocarboxylic acid anion (CHEBI:36059) |
| 5-[(E)-caffeoyl]shikimate (CHEBI:91005) is conjugate base of 5-[(E)-caffeoyl]shikimic acid (CHEBI:2106) |
| Incoming Relation(s) |
| 5-[(E)-caffeoyl]shikimic acid (CHEBI:2106) is conjugate acid of 5-[(E)-caffeoyl]shikimate (CHEBI:91005) |
| IUPAC Name |
|---|
| (3R,4R,5R)-5-{[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}-3,4-dihydroxycyclohex-1-ene-1-carboxylate |
| Synonyms | Source |
|---|---|
| 5-caffeoylshikimate | ChEBI |
| 5-O-caffeoylshikimate | ChEBI |
| 5-(trans-caffeoyl)shikimate | ChEBI |
| caffeoylshikimate | ChEBI |
| UniProt Name | Source |
|---|---|
| 5-O-[(E)-caffeoyl]-shikimate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 24784746 | ChemSpider |
| CAFFEOYLSHIKIMATE | MetaCyc |
| Citations |
|---|