EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H6O6S |
| Net Charge | 0 |
| Average Mass | 242.208 |
| Monoisotopic Mass | 241.98851 |
| SMILES | O=c1ccc2ccc(OS(=O)(=O)O)cc2o1 |
| InChI | InChI=1S/C9H6O6S/c10-9-4-2-6-1-3-7(5-8(6)14-9)15-16(11,12)13/h1-5H,(H,11,12,13) |
| InChIKey | LJOOSFYJELZGMR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (9800648) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (9800648) |
| Roles Classification |
|---|
| Biological Roles: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| umbelliferone sulfate (CHEBI:133565) has functional parent umbelliferone (CHEBI:27510) |
| umbelliferone sulfate (CHEBI:133565) has role human urinary metabolite (CHEBI:84087) |
| umbelliferone sulfate (CHEBI:133565) has role human xenobiotic metabolite (CHEBI:76967) |
| umbelliferone sulfate (CHEBI:133565) has role mouse metabolite (CHEBI:75771) |
| umbelliferone sulfate (CHEBI:133565) is a aryl sulfate (CHEBI:37919) |
| umbelliferone sulfate (CHEBI:133565) is a coumarins (CHEBI:23403) |
| umbelliferone sulfate (CHEBI:133565) is conjugate acid of umbelliferone sulfate(1−) (CHEBI:133567) |
| Incoming Relation(s) |
| 4-methylumbelliferone sulfate (CHEBI:1905) has functional parent umbelliferone sulfate (CHEBI:133565) |
| umbelliferone sulfate(1−) (CHEBI:133567) is conjugate base of umbelliferone sulfate (CHEBI:133565) |
| IUPAC Name |
|---|
| 2-oxo-2H-1-benzopyran-7-yl hydrogen sulfate |
| Synonyms | Source |
|---|---|
| 7-hydroxycoumarin sulfate | ChEBI |
| 7-Hydroxycoumarin sulfate ester | ChemIDplus |
| 7-sulfooxycoumarin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21797 | Reaxys |
| CAS:69526-88-1 | ChemIDplus |
| Citations |
|---|