EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11NS3.HCl |
| Net Charge | 0 |
| Average Mass | 217.812 |
| Monoisotopic Mass | 216.98204 |
| SMILES | CN(C)C1CSSSC1.Cl |
| InChI | InChI=1S/C5H11NS3.ClH/c1-6(2)5-3-7-9-8-4-5;/h5H,3-4H2,1-2H3;1H |
| InChIKey | DYLDNPYVDMQCFR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. |
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiocyclam hydrochloride (CHEBI:133554) has part thiocyclam(1+) (CHEBI:133552) |
| thiocyclam hydrochloride (CHEBI:133554) has role agrochemical (CHEBI:33286) |
| thiocyclam hydrochloride (CHEBI:133554) has role insecticide (CHEBI:24852) |
| thiocyclam hydrochloride (CHEBI:133554) has role nicotinic acetylcholine receptor agonist (CHEBI:47958) |
| thiocyclam hydrochloride (CHEBI:133554) is a hydrochloride (CHEBI:36807) |
| IUPAC Names |
|---|
| N,N-dimethyl-1,2,3-trithian-5-amine hydrochloride |
| N,N-dimethyl-1,2,3-trithian-5-aminium chloride |
| Synonyms | Source |
|---|---|
| N,N-dimethyl-1,2,3-trithian-5-amine hydrochloride (1:1) | Alan Wood's Pesticides |
| thiocyclam HCl | ChEBI |
| thiocyclam.HCl | ChEBI |
| trithialan | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| derivatives/thiocyclam%20hydrochloride | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:32828398 | Reaxys |
| CAS:75655-75-3 | Alan Wood's Pesticides |