EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11NS3.HCl |
| Net Charge | 0 |
| Average Mass | 217.812 |
| Monoisotopic Mass | 216.98204 |
| SMILES | CN(C)C1CSSSC1.Cl |
| InChI | InChI=1S/C5H11NS3.ClH/c1-6(2)5-3-7-9-8-4-5;/h5H,3-4H2,1-2H3;1H |
| InChIKey | DYLDNPYVDMQCFR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. |
| Applications: | nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiocyclam hydrochloride (CHEBI:133554) has part thiocyclam(1+) (CHEBI:133552) |
| thiocyclam hydrochloride (CHEBI:133554) has role agrochemical (CHEBI:33286) |
| thiocyclam hydrochloride (CHEBI:133554) has role insecticide (CHEBI:24852) |
| thiocyclam hydrochloride (CHEBI:133554) has role nicotinic acetylcholine receptor agonist (CHEBI:47958) |
| thiocyclam hydrochloride (CHEBI:133554) is a hydrochloride (CHEBI:36807) |
| IUPAC Names |
|---|
| N,N-dimethyl-1,2,3-trithian-5-amine hydrochloride |
| N,N-dimethyl-1,2,3-trithian-5-aminium chloride |
| Synonyms | Source |
|---|---|
| N,N-dimethyl-1,2,3-trithian-5-amine hydrochloride (1:1) | Alan Wood's Pesticides |
| thiocyclam HCl | ChEBI |
| thiocyclam.HCl | ChEBI |
| trithialan | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| derivatives/thiocyclam%20hydrochloride | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:32828398 | Reaxys |
| CAS:75655-75-3 | Alan Wood's Pesticides |